C20H19NO5S2 — CID 27990157
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 27990157) has the molecular formula C20H19NO5S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 27990157 |
| Molecular Formula | C20H19NO5S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C20H19NO5S2/c1-24-17-12-13(19-27-10-11-28-19)6-7-16(17)25-18(22)8-9-21-14-4-2-3-5-15(14)26-20(21)23/h2-7,12,19H,8-11H2,1H3 |
| InChIKey | HAIXCGGOURCSPC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|