C18H21NO4 — CID 94870958
[(1S,6S)-6-methylcyclohex-3-en-1-yl]methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 94870958) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(1S,6S)-6-methylcyclohex-3-en-1-yl]methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | [(1S,6S)-6-methylcyclohex-3-en-1-yl]methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 94870958 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [(1S,6S)-6-methylcyclohex-3-en-1-yl]methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | C[C@H]1CC=CC[C@@H]1COC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C18H21NO4/c1-13-6-2-3-7-14(13)12-22-17(20)10-11-19-15-8-4-5-9-16(15)23-18(19)21/h2-5,8-9,13-14H,6-7,10-12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | BRAWSDVIAHMFOE-UONOGXRCSA-N |
| XLogP | 3.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|