C18H16FNO5 — CID 8727481
2-(4-fluorophenoxy)ethyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 8727481) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 8727481 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | O=C(CCn1c(=O)oc2ccccc21)OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO5/c19-13-5-7-14(8-6-13)23-11-12-24-17(21)9-10-20-15-3-1-2-4-16(15)25-18(20)22/h1-8H,9-12H2 |
| InChIKey | UFRZXAHDBAVUAT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|