C11H11NO4 — CID 142790595
2-(2-oxo-1,3-benzoxazol-3-yl)ethyl acetate (PubChem CID 142790595) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(2-oxo-1,3-benzoxazol-3-yl)ethyl acetate.
| Compound Name | 2-(2-oxo-1,3-benzoxazol-3-yl)ethyl acetate |
|---|---|
| PubChem CID | 142790595 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(2-oxo-1,3-benzoxazol-3-yl)ethyl acetate |
| SMILES | CC(=O)OCCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C11H11NO4/c1-8(13)15-7-6-12-9-4-2-3-5-10(9)16-11(12)14/h2-5H,6-7H2,1H3 |
| InChIKey | SRVGICQWNZQCOA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |