C10H11NO5S — CID 19418949
2-(2-oxo-1,3-benzoxazol-3-yl)ethyl methanesulfonate (PubChem CID 19418949) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-(2-oxo-1,3-benzoxazol-3-yl)ethyl methanesulfonate.
| Compound Name | 2-(2-oxo-1,3-benzoxazol-3-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 19418949 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-(2-oxo-1,3-benzoxazol-3-yl)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C10H11NO5S/c1-17(13,14)15-7-6-11-8-4-2-3-5-9(8)16-10(11)12/h2-5H,6-7H2,1H3 |
| InChIKey | XUEZJCGJEFCVSJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|