C13H16N2O2S — CID 65248701
2,2-dimethyl-4-(2-oxo-1,3-benzoxazol-3-yl)butanethioamide (PubChem CID 65248701) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-oxo-1,3-benzoxazol-3-yl)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(2-oxo-1,3-benzoxazol-3-yl)butanethioamide |
|---|---|
| PubChem CID | 65248701 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2,2-dimethyl-4-(2-oxo-1,3-benzoxazol-3-yl)butanethioamide |
| SMILES | CC(C)(CCn1c(=O)oc2ccccc21)C(N)=S |
| InChI | InChI=1S/C13H16N2O2S/c1-13(2,11(14)18)7-8-15-9-5-3-4-6-10(9)17-12(15)16/h3-6H,7-8H2,1-2H3,(H2,14,18) |
| InChIKey | GORWAHBLRVGKJE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|