C23H23NO7 — CID 10295973
diethyl 2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methylidene]propanedioate (PubChem CID 10295973) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is diethyl 2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 10295973 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | diethyl 2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1ccc(OCCn2c(=O)oc3ccccc32)cc1)C(=O)OCC |
| InChI | InChI=1S/C23H23NO7/c1-3-28-21(25)18(22(26)29-4-2)15-16-9-11-17(12-10-16)30-14-13-24-19-7-5-6-8-20(19)31-23(24)27/h5-12,15H,3-4,13-14H2,1-2H3 |
| InChIKey | XZPPSQZLRAAUJC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|