C21H21NO7 — CID 10179028
3-ethoxy-3-oxo-2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanoic acid (PubChem CID 10179028) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is 3-ethoxy-3-oxo-2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanoic acid.
| Compound Name | 3-ethoxy-3-oxo-2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanoic acid |
|---|---|
| PubChem CID | 10179028 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-ethoxy-3-oxo-2-[[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanoic acid |
| SMILES | CCOC(=O)C(Cc1ccc(OCCn2c(=O)oc3ccccc32)cc1)C(=O)O |
| InChI | InChI=1S/C21H21NO7/c1-2-27-20(25)16(19(23)24)13-14-7-9-15(10-8-14)28-12-11-22-17-5-3-4-6-18(17)29-21(22)26/h3-10,16H,2,11-13H2,1H3,(H,23,24) |
| InChIKey | XOMUEKJGHKBIRW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|