C28H27NO7 — CID 22351081
dimethyl 2-[[4-[2-(6-benzyl-2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanedioate (PubChem CID 22351081) has the molecular formula C28H27NO7 and a molecular weight of 489.52 g/mol. Its IUPAC name is dimethyl 2-[[4-[2-(6-benzyl-2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[4-[2-(6-benzyl-2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 22351081 |
| Molecular Formula | C28H27NO7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | dimethyl 2-[[4-[2-(6-benzyl-2-oxo-1,3-benzoxazol-3-yl)ethoxy]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc(OCCn2c(=O)oc3cc(Cc4ccccc4)ccc32)cc1)C(=O)OC |
| InChI | InChI=1S/C28H27NO7/c1-33-26(30)23(27(31)34-2)17-20-8-11-22(12-9-20)35-15-14-29-24-13-10-21(18-25(24)36-28(29)32)16-19-6-4-3-5-7-19/h3-13,18,23H,14-17H2,1-2H3 |
| InChIKey | AVNWZIXAKHOSOV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|