C28H24ClNO7S — CID 22351084
dimethyl 2-[[4-[2-[6-(2-chlorobenzoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate (PubChem CID 22351084) has the molecular formula C28H24ClNO7S and a molecular weight of 554.02 g/mol. Its IUPAC name is dimethyl 2-[[4-[2-[6-(2-chlorobenzoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[4-[2-[6-(2-chlorobenzoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 22351084 |
| Molecular Formula | C28H24ClNO7S |
| Molecular Weight | 554.02 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | dimethyl 2-[[4-[2-[6-(2-chlorobenzoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc(OCCn2c(=O)sc3cc(C(=O)c4ccccc4Cl)ccc32)cc1)C(=O)OC |
| InChI | InChI=1S/C28H24ClNO7S/c1-35-26(32)21(27(33)36-2)15-17-7-10-19(11-8-17)37-14-13-30-23-12-9-18(16-24(23)38-28(30)34)25(31)20-5-3-4-6-22(20)29/h3-12,16,21H,13-15H2,1-2H3 |
| InChIKey | UKTBBMUEIHEGHI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.02 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|