C26H23ClN2O6S — CID 87884993
2-[4-[2-[6-[(E)-C-(3-chlorophenyl)-N-hydroxycarbonimidoyl]-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenoxy]-2-methylpropanoic acid (PubChem CID 87884993) has the molecular formula C26H23ClN2O6S and a molecular weight of 527.00 g/mol. Its IUPAC name is 2-[4-[2-[6-[(E)-C-(3-chlorophenyl)-N-hydroxycarbonimidoyl]-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[6-[(E)-C-(3-chlorophenyl)-N-hydroxycarbonimidoyl]-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87884993 |
| Molecular Formula | C26H23ClN2O6S |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 2-[4-[2-[6-[(E)-C-(3-chlorophenyl)-N-hydroxycarbonimidoyl]-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(OCCn2c(=O)sc3cc(/C(=N\O)c4cccc(Cl)c4)ccc32)cc1)C(=O)O |
| InChI | InChI=1S/C26H23ClN2O6S/c1-26(2,24(30)31)35-20-9-7-19(8-10-20)34-13-12-29-21-11-6-17(15-22(21)36-25(29)32)23(28-33)16-4-3-5-18(27)14-16/h3-11,14-15,33H,12-13H2,1-2H3,(H,30,31)/b28-23- |
| InChIKey | AMZBOJGXJKTDJP-NFFVHWSESA-N |
| XLogP | 5.26 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|