C28H28N2O6S — CID 73414987
2-[4-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoic acid (PubChem CID 73414987) has the molecular formula C28H28N2O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is 2-[4-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 73414987 |
| Molecular Formula | C28H28N2O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-[4-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoic acid |
| SMILES | CON=C(c1ccccc1)c1ccc2c(c1)sc(=O)n2CCCOc1ccc(OC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C28H28N2O6S/c1-28(2,26(31)32)36-22-13-11-21(12-14-22)35-17-7-16-30-23-15-10-20(18-24(23)37-27(30)33)25(29-34-3)19-8-5-4-6-9-19/h4-6,8-15,18H,7,16-17H2,1-3H3,(H,31,32) |
| InChIKey | SUYHFVBZTJHAPN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|