C32H25N2O6S- — CID 23103793
2-benzamido-3-[4-[2-(6-benzoyl-2-oxo-1,3-benzothiazol-3-yl)ethoxy]phenyl]propanoate (PubChem CID 23103793) has the molecular formula C32H25N2O6S- and a molecular weight of 565.63 g/mol. Its IUPAC name is 2-benzamido-3-[4-[2-(6-benzoyl-2-oxo-1,3-benzothiazol-3-yl)ethoxy]phenyl]propanoate.
| Compound Name | 2-benzamido-3-[4-[2-(6-benzoyl-2-oxo-1,3-benzothiazol-3-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 23103793 |
| Molecular Formula | C32H25N2O6S- |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 2-benzamido-3-[4-[2-(6-benzoyl-2-oxo-1,3-benzothiazol-3-yl)ethoxy]phenyl]propanoate |
| SMILES | O=C(NC(Cc1ccc(OCCn2c(=O)sc3cc(C(=O)c4ccccc4)ccc32)cc1)C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C32H26N2O6S/c35-29(22-7-3-1-4-8-22)24-13-16-27-28(20-24)41-32(39)34(27)17-18-40-25-14-11-21(12-15-25)19-26(31(37)38)33-30(36)23-9-5-2-6-10-23/h1-16,20,26H,17-19H2,(H,33,36)(H,37,38)/p-1 |
| InChIKey | KVTJBBGAXYFZGF-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |