C22H24N2O2S — CID 25196534
3-[2-(azepan-1-yl)ethyl]-6-benzoyl-1,3-benzothiazol-2-one (PubChem CID 25196534) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)ethyl]-6-benzoyl-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-(azepan-1-yl)ethyl]-6-benzoyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 25196534 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-[2-(azepan-1-yl)ethyl]-6-benzoyl-1,3-benzothiazol-2-one |
| SMILES | O=C(c1ccccc1)c1ccc2c(c1)sc(=O)n2CCN1CCCCCC1 |
| InChI | InChI=1S/C22H24N2O2S/c25-21(17-8-4-3-5-9-17)18-10-11-19-20(16-18)27-22(26)24(19)15-14-23-12-6-1-2-7-13-23/h3-5,8-11,16H,1-2,6-7,12-15H2 |
| InChIKey | SNUDTLFHTMHYMB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |