C22H33ClN2O2S — CID 71818438
3-[6-(azepan-1-yl)hexyl]-6-propanoyl-1,3-benzothiazol-2-one;hydrochloride (PubChem CID 71818438) has the molecular formula C22H33ClN2O2S and a molecular weight of 425.04 g/mol. Its IUPAC name is 3-[6-(azepan-1-yl)hexyl]-6-propanoyl-1,3-benzothiazol-2-one;hydrochloride.
| Compound Name | 3-[6-(azepan-1-yl)hexyl]-6-propanoyl-1,3-benzothiazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 71818438 |
| Molecular Formula | C22H33ClN2O2S |
| Molecular Weight | 425.04 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-[6-(azepan-1-yl)hexyl]-6-propanoyl-1,3-benzothiazol-2-one;hydrochloride |
| SMILES | CCC(=O)c1ccc2c(c1)sc(=O)n2CCCCCCN1CCCCCC1.Cl |
| InChI | InChI=1S/C22H32N2O2S.ClH/c1-2-20(25)18-11-12-19-21(17-18)27-22(26)24(19)16-10-6-5-9-15-23-13-7-3-4-8-14-23;/h11-12,17H,2-10,13-16H2,1H3;1H |
| InChIKey | CGXNVWNPEPKTKD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.04 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|