C32H29NO6S — CID 22351087
dimethyl 2-[[4-[2-[6-(naphthalen-1-ylmethyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate (PubChem CID 22351087) has the molecular formula C32H29NO6S and a molecular weight of 555.65 g/mol. Its IUPAC name is dimethyl 2-[[4-[2-[6-(naphthalen-1-ylmethyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[4-[2-[6-(naphthalen-1-ylmethyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 22351087 |
| Molecular Formula | C32H29NO6S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | dimethyl 2-[[4-[2-[6-(naphthalen-1-ylmethyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc(OCCn2c(=O)sc3cc(Cc4cccc5ccccc45)ccc32)cc1)C(=O)OC |
| InChI | InChI=1S/C32H29NO6S/c1-37-30(34)27(31(35)38-2)19-21-10-13-25(14-11-21)39-17-16-33-28-15-12-22(20-29(28)40-32(33)36)18-24-8-5-7-23-6-3-4-9-26(23)24/h3-15,20,27H,16-19H2,1-2H3 |
| InChIKey | FELPFTZBWZTNFK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|