C30H32N2O6S — CID 87906499
methyl 2-[3-[4-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]butoxy]phenoxy]-2-methylpropanoate (PubChem CID 87906499) has the molecular formula C30H32N2O6S and a molecular weight of 548.66 g/mol. Its IUPAC name is methyl 2-[3-[4-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]butoxy]phenoxy]-2-methylpropanoate.
| Compound Name | methyl 2-[3-[4-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]butoxy]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 87906499 |
| Molecular Formula | C30H32N2O6S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | methyl 2-[3-[4-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]butoxy]phenoxy]-2-methylpropanoate |
| SMILES | CON=C(c1ccccc1)c1ccc2c(c1)sc(=O)n2CCCCOc1cccc(OC(C)(C)C(=O)OC)c1 |
| InChI | InChI=1S/C30H32N2O6S/c1-30(2,28(33)35-3)38-24-14-10-13-23(20-24)37-18-9-8-17-32-25-16-15-22(19-26(25)39-29(32)34)27(31-36-4)21-11-6-5-7-12-21/h5-7,10-16,19-20H,8-9,17-18H2,1-4H3 |
| InChIKey | PVMHIANCNPFYIF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|