C28H25F3N2O6S — CID 154297958
2-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid (PubChem CID 154297958) has the molecular formula C28H25F3N2O6S and a molecular weight of 574.58 g/mol. Its IUPAC name is 2-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid.
| Compound Name | 2-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid |
|---|---|
| PubChem CID | 154297958 |
| Molecular Formula | C28H25F3N2O6S |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 2-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid |
| SMILES | CON=C(c1ccccc1)c1ccc2c(c1)sc(=O)n2CCOc1ccc(C(C)(OCC(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C28H25F3N2O6S/c1-27(25(34)35,39-17-28(29,30)31)20-9-11-21(12-10-20)38-15-14-33-22-13-8-19(16-23(22)40-26(33)36)24(32-37-2)18-6-4-3-5-7-18/h3-13,16H,14-15,17H2,1-2H3,(H,34,35) |
| InChIKey | LITGYFWEAFPOGG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|