C29H30N2O6S — CID 87906496
methyl 2-[3-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoate (PubChem CID 87906496) has the molecular formula C29H30N2O6S and a molecular weight of 534.63 g/mol. Its IUPAC name is methyl 2-[3-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoate.
| Compound Name | methyl 2-[3-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 87906496 |
| Molecular Formula | C29H30N2O6S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | methyl 2-[3-[3-[6-(N-methoxy-C-phenylcarbonimidoyl)-2-oxo-1,3-benzothiazol-3-yl]propoxy]phenoxy]-2-methylpropanoate |
| SMILES | CON=C(c1ccccc1)c1ccc2c(c1)sc(=O)n2CCCOc1cccc(OC(C)(C)C(=O)OC)c1 |
| InChI | InChI=1S/C29H30N2O6S/c1-29(2,27(32)34-3)37-23-13-8-12-22(19-23)36-17-9-16-31-24-15-14-21(18-25(24)38-28(31)33)26(30-35-4)20-10-6-5-7-11-20/h5-8,10-15,18-19H,9,16-17H2,1-4H3 |
| InChIKey | VJSWGEQSYKQSQT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|