C18H17NO4 — CID 18823364
(2,5-dimethylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 18823364) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | (2,5-dimethylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 18823364 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2,5-dimethylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | Cc1ccc(C)c(OC(=O)CCn2c(=O)oc3ccccc32)c1 |
| InChI | InChI=1S/C18H17NO4/c1-12-7-8-13(2)16(11-12)22-17(20)9-10-19-14-5-3-4-6-15(14)23-18(19)21/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | MTWFJZGBQRIBQL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|