C22H17NO6 — CID 16561146
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 16561146) has the molecular formula C22H17NO6 and a molecular weight of 391.38 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 16561146 |
| Molecular Formula | C22H17NO6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | O=C(CCn1c(=O)oc2ccccc21)Oc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C22H17NO6/c24-20(10-11-23-17-6-1-2-7-18(17)29-22(23)26)27-13-8-9-15-14-4-3-5-16(14)21(25)28-19(15)12-13/h1-2,6-9,12H,3-5,10-11H2 |
| InChIKey | KBNORCXBSJSRLA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|