C22H20O4S — CID 22831096
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 4-phenylsulfanylbutanoate (PubChem CID 22831096) has the molecular formula C22H20O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 4-phenylsulfanylbutanoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 4-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 22831096 |
| Molecular Formula | C22H20O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 4-phenylsulfanylbutanoate |
| SMILES | O=C(CCCSc1ccccc1)Oc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C22H20O4S/c23-21(10-5-13-27-16-6-2-1-3-7-16)25-15-11-12-18-17-8-4-9-19(17)22(24)26-20(18)14-15/h1-3,6-7,11-12,14H,4-5,8-10,13H2 |
| InChIKey | NFLGJYSVHVARSV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|