C19H17NO6S2 — CID 16558604
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate (PubChem CID 16558604) has the molecular formula C19H17NO6S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 16558604 |
| Molecular Formula | C19H17NO6S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
| SMILES | CN(CC(=O)Oc1ccc2c3c(c(=O)oc2c1)CCC3)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H17NO6S2/c1-20(28(23,24)18-6-3-9-27-18)11-17(21)25-12-7-8-14-13-4-2-5-15(13)19(22)26-16(14)10-12/h3,6-10H,2,4-5,11H2,1H3 |
| InChIKey | KBUXSWUZJPVTQC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|