C22H20O7 — CID 7698711
(2,6-dimethoxyphenyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate (PubChem CID 7698711) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate.
| Compound Name | (2,6-dimethoxyphenyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 7698711 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (2,6-dimethoxyphenyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
| SMILES | COc1cccc(OC)c1OC(=O)COc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C22H20O7/c1-25-17-7-4-8-18(26-2)21(17)29-20(23)12-27-13-9-10-15-14-5-3-6-16(14)22(24)28-19(15)11-13/h4,7-11H,3,5-6,12H2,1-2H3 |
| InChIKey | JSBRWZLPOGGKNN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|