C19H21NO7 — CID 7983098
[2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate (PubChem CID 7983098) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 7983098 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
| SMILES | COCCNC(=O)COC(=O)COc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C19H21NO7/c1-24-8-7-20-17(21)10-26-18(22)11-25-12-5-6-14-13-3-2-4-15(13)19(23)27-16(14)9-12/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,20,21) |
| InChIKey | NBPRAGVMRZAPIE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|