C21H24O5 — CID 2222389
cyclohexyl 2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetate (PubChem CID 2222389) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is cyclohexyl 2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetate.
| Compound Name | cyclohexyl 2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetate |
|---|---|
| PubChem CID | 2222389 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | cyclohexyl 2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetate |
| SMILES | O=C(COc1ccc2c3c(c(=O)oc2c1)CCCC3)OC1CCCCC1 |
| InChI | InChI=1S/C21H24O5/c22-20(25-14-6-2-1-3-7-14)13-24-15-10-11-17-16-8-4-5-9-18(16)21(23)26-19(17)12-15/h10-12,14H,1-9,13H2 |
| InChIKey | YJOAOQFQYFXCAW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|