C16H17NO3S — CID 15714359
O-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)] N,N-dimethylcarbamothioate (PubChem CID 15714359) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is O-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)] N,N-dimethylcarbamothioate.
| Compound Name | O-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 15714359 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | O-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1ccc2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C16H17NO3S/c1-17(2)16(21)19-10-7-8-12-11-5-3-4-6-13(11)15(18)20-14(12)9-10/h7-9H,3-6H2,1-2H3 |
| InChIKey | FNUNQZDGUXOIJI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|