C18H22O5S — CID 73213114
(9-oxo-8-oxatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5-tetraen-5-yl) propane-1-sulfonate (PubChem CID 73213114) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is (9-oxo-8-oxatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5-tetraen-5-yl) propane-1-sulfonate.
| Compound Name | (9-oxo-8-oxatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5-tetraen-5-yl) propane-1-sulfonate |
|---|---|
| PubChem CID | 73213114 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (9-oxo-8-oxatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5-tetraen-5-yl) propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1ccc2c3c(c(=O)oc2c1)CCCCCC3 |
| InChI | InChI=1S/C18H22O5S/c1-2-11-24(20,21)23-13-9-10-15-14-7-5-3-4-6-8-16(14)18(19)22-17(15)12-13/h9-10,12H,2-8,11H2,1H3 |
| InChIKey | ASTIXQNOCMZFEM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|