C20H22O4 — CID 931760
3-[(1R)-2-oxocyclohexyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one (PubChem CID 931760) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 3-[(1R)-2-oxocyclohexyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one.
| Compound Name | 3-[(1R)-2-oxocyclohexyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
|---|---|
| PubChem CID | 931760 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-[(1R)-2-oxocyclohexyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
| SMILES | O=C1CCCC[C@H]1Oc1ccc2c3c(c(=O)oc2c1)CCCCC3 |
| InChI | InChI=1S/C20H22O4/c21-17-8-4-5-9-18(17)23-13-10-11-15-14-6-2-1-3-7-16(14)20(22)24-19(15)12-13/h10-12,18H,1-9H2/t18-/m1/s1 |
| InChIKey | QPCILIIUPIOWGM-GOSISDBHSA-N |
| XLogP | 3.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|