C19H20O4 — CID 2270432
3-[(1R)-2-oxocyclohexyl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 2270432) has the molecular formula C19H20O4 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[(1R)-2-oxocyclohexyl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[(1R)-2-oxocyclohexyl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 2270432 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-[(1R)-2-oxocyclohexyl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | O=C1CCCC[C@H]1Oc1ccc2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C19H20O4/c20-16-7-3-4-8-17(16)22-12-9-10-14-13-5-1-2-6-15(13)19(21)23-18(14)11-12/h9-11,17H,1-8H2/t17-/m1/s1 |
| InChIKey | RGFAFZQQHGKWEB-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|