C27H30O6 — CID 2071888
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(4-butoxy-3-ethoxyphenyl)propanoate (PubChem CID 2071888) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(4-butoxy-3-ethoxyphenyl)propanoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(4-butoxy-3-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 2071888 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(4-butoxy-3-ethoxyphenyl)propanoate |
| SMILES | CCCCOc1ccc(CCC(=O)Oc2ccc3c4c(c(=O)oc3c2)CCC4)cc1OCC |
| InChI | InChI=1S/C27H30O6/c1-3-5-15-31-23-13-9-18(16-25(23)30-4-2)10-14-26(28)32-19-11-12-21-20-7-6-8-22(20)27(29)33-24(21)17-19/h9,11-13,16-17H,3-8,10,14-15H2,1-2H3 |
| InChIKey | NVUCUOFZEBGOFR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|