C24H32O4 — CID 2071868
(4-propan-2-ylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate (PubChem CID 2071868) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate.
| Compound Name | (4-propan-2-ylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 2071868 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (4-propan-2-ylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate |
| SMILES | CCCCOc1ccc(CCC(=O)Oc2ccc(C(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C24H32O4/c1-5-7-16-27-22-14-8-19(17-23(22)26-6-2)9-15-24(25)28-21-12-10-20(11-13-21)18(3)4/h8,10-14,17-18H,5-7,9,15-16H2,1-4H3 |
| InChIKey | VZUFEPQCSBZGII-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|