C28H30ClNO5 — CID 19237022
[4-[(4-chlorophenyl)carbamoyl]phenyl] 3-(4-butoxy-3-ethoxyphenyl)propanoate (PubChem CID 19237022) has the molecular formula C28H30ClNO5 and a molecular weight of 496.00 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)carbamoyl]phenyl] 3-(4-butoxy-3-ethoxyphenyl)propanoate.
| Compound Name | [4-[(4-chlorophenyl)carbamoyl]phenyl] 3-(4-butoxy-3-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 19237022 |
| Molecular Formula | C28H30ClNO5 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [4-[(4-chlorophenyl)carbamoyl]phenyl] 3-(4-butoxy-3-ethoxyphenyl)propanoate |
| SMILES | CCCCOc1ccc(CCC(=O)Oc2ccc(C(=O)Nc3ccc(Cl)cc3)cc2)cc1OCC |
| InChI | InChI=1S/C28H30ClNO5/c1-3-5-18-34-25-16-6-20(19-26(25)33-4-2)7-17-27(31)35-24-14-8-21(9-15-24)28(32)30-23-12-10-22(29)11-13-23/h6,8-16,19H,3-5,7,17-18H2,1-2H3,(H,30,32) |
| InChIKey | CCWHVMWIWZWXTK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|