C22H27ClO4 — CID 2071877
(4-chloro-3-methylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate (PubChem CID 2071877) has the molecular formula C22H27ClO4 and a molecular weight of 390.91 g/mol. Its IUPAC name is (4-chloro-3-methylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate.
| Compound Name | (4-chloro-3-methylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 2071877 |
| Molecular Formula | C22H27ClO4 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (4-chloro-3-methylphenyl) 3-(4-butoxy-3-ethoxyphenyl)propanoate |
| SMILES | CCCCOc1ccc(CCC(=O)Oc2ccc(Cl)c(C)c2)cc1OCC |
| InChI | InChI=1S/C22H27ClO4/c1-4-6-13-26-20-11-7-17(15-21(20)25-5-2)8-12-22(24)27-18-9-10-19(23)16(3)14-18/h7,9-11,14-15H,4-6,8,12-13H2,1-3H3 |
| InChIKey | JWNUHADSHCIBHK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|