C17H11ClN2O4 — CID 18207225
(3-cyanophenyl) 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 18207225) has the molecular formula C17H11ClN2O4 and a molecular weight of 342.74 g/mol. Its IUPAC name is (3-cyanophenyl) 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | (3-cyanophenyl) 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 18207225 |
| Molecular Formula | C17H11ClN2O4 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (3-cyanophenyl) 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | N#Cc1cccc(OC(=O)CCn2c(=O)oc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C17H11ClN2O4/c18-12-4-5-14-15(9-12)24-17(22)20(14)7-6-16(21)23-13-3-1-2-11(8-13)10-19/h1-5,8-9H,6-7H2 |
| InChIKey | LXDUUEKBBGAAIE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|