C16H15NO3S — CID 656169
3-[2-(2-methoxyphenoxy)ethyl]-1,3-benzothiazol-2-one (PubChem CID 656169) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-[2-(2-methoxyphenoxy)ethyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-(2-methoxyphenoxy)ethyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 656169 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-[2-(2-methoxyphenoxy)ethyl]-1,3-benzothiazol-2-one |
| SMILES | COc1ccccc1OCCn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C16H15NO3S/c1-19-13-7-3-4-8-14(13)20-11-10-17-12-6-2-5-9-15(12)21-16(17)18/h2-9H,10-11H2,1H3 |
| InChIKey | QGLZFPCRHDLCIQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |