C16H14ClNO2S — CID 3898051
3-[3-(2-chlorophenoxy)propyl]-1,3-benzothiazol-2-one (PubChem CID 3898051) has the molecular formula C16H14ClNO2S and a molecular weight of 319.81 g/mol. Its IUPAC name is 3-[3-(2-chlorophenoxy)propyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[3-(2-chlorophenoxy)propyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 3898051 |
| Molecular Formula | C16H14ClNO2S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3-[3-(2-chlorophenoxy)propyl]-1,3-benzothiazol-2-one |
| SMILES | O=c1sc2ccccc2n1CCCOc1ccccc1Cl |
| InChI | InChI=1S/C16H14ClNO2S/c17-12-6-1-3-8-14(12)20-11-5-10-18-13-7-2-4-9-15(13)21-16(18)19/h1-4,6-9H,5,10-11H2 |
| InChIKey | AZDSJSFJKKSRTR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|