C15H11Cl2NO2S — CID 18823322
3-[2-(2,4-dichlorophenoxy)ethyl]-1,3-benzothiazol-2-one (PubChem CID 18823322) has the molecular formula C15H11Cl2NO2S and a molecular weight of 340.23 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 18823322 |
| Molecular Formula | C15H11Cl2NO2S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-1,3-benzothiazol-2-one |
| SMILES | O=c1sc2ccccc2n1CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO2S/c16-10-5-6-13(11(17)9-10)20-8-7-18-12-3-1-2-4-14(12)21-15(18)19/h1-6,9H,7-8H2 |
| InChIKey | PZMWKTFZHHIRAV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |