C9H8NOS2- — CID 3924477
2-(2-oxo-1,3-benzothiazol-3-yl)ethanethiolate (PubChem CID 3924477) has the molecular formula C9H8NOS2- and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(2-oxo-1,3-benzothiazol-3-yl)ethanethiolate.
| Compound Name | 2-(2-oxo-1,3-benzothiazol-3-yl)ethanethiolate |
|---|---|
| PubChem CID | 3924477 |
| Molecular Formula | C9H8NOS2- |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-(2-oxo-1,3-benzothiazol-3-yl)ethanethiolate |
| SMILES | O=c1sc2ccccc2n1CC[S-] |
| InChI | InChI=1S/C9H9NOS2/c11-9-10(5-6-12)7-3-1-2-4-8(7)13-9/h1-4,12H,5-6H2/p-1 |
| InChIKey | GOXHALFSYVMMHX-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|