About trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide
trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide (PubChem CID 126957521) has the molecular formula C11H16BrN2OS+
and a molecular weight of 304.23 g/mol. Its IUPAC name is trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide.
Molecular Properties
| Compound Name | trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide |
| PubChem CID | 126957521 |
| Molecular Formula | C11H16BrN2OS+ |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide |
| SMILES | Br.C[N+](C)(C)Cn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C11H15N2OS.BrH/c1-13(2,3)8-12-9-6-4-5-7-10(9)15-11(12)14;/h4-7H,8H2,1-3H3;1H/q+1; |
| InChIKey | GPKRYIPNEPWBLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide?
The IUPAC name of trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide (CID 126957521) is trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide.
What is the SMILES notation for trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide?
The canonical SMILES for trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide is Br.C[N+](C)(C)Cn1c(=O)sc2ccccc21.
What is the InChIKey of trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide?
The InChIKey is GPKRYIPNEPWBLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N2OS.BrH/c1-13(2,3)8-12-9-6-4-5-7-10(9)15-11(12)14;/h4-7H,8H2,1-3H3;1H/q+1;.
What are the key properties of trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide?
trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide has a molecular weight of 304.23 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide is sourced from PubChem (CID 126957521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).