C11H16BrN2OS+ — CID 126957521
trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide (PubChem CID 126957521) has the molecular formula C11H16BrN2OS+ and a molecular weight of 304.23 g/mol. Its IUPAC name is trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide.
| Compound Name | trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide |
|---|---|
| PubChem CID | 126957521 |
| Molecular Formula | C11H16BrN2OS+ |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | trimethyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium;hydrobromide |
| SMILES | Br.C[N+](C)(C)Cn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C11H15N2OS.BrH/c1-13(2,3)8-12-9-6-4-5-7-10(9)15-11(12)14;/h4-7H,8H2,1-3H3;1H/q+1; |
| InChIKey | GPKRYIPNEPWBLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|