C32H57ClN2OS — CID 11965072
trioctyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium chloride (PubChem CID 11965072) has the molecular formula C32H57ClN2OS and a molecular weight of 553.34 g/mol. Its IUPAC name is trioctyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium chloride.
| Compound Name | trioctyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium chloride |
|---|---|
| PubChem CID | 11965072 |
| Molecular Formula | C32H57ClN2OS |
| Molecular Weight | 553.34 g/mol |
| Exact Mass | 552.39 |
| IUPAC Name | trioctyl-[(2-oxo-1,3-benzothiazol-3-yl)methyl]azanium chloride |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)Cn1c(=O)sc2ccccc21.[Cl-] |
| InChI | InChI=1S/C32H57N2OS.ClH/c1-4-7-10-13-16-21-26-34(27-22-17-14-11-8-5-2,28-23-18-15-12-9-6-3)29-33-30-24-19-20-25-31(30)36-32(33)35;/h19-20,24-25H,4-18,21-23,26-29H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RNCBDQHOWSTVNB-UHFFFAOYSA-M |
| XLogP | 6.92 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.34 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|