C14H17N3O2S — CID 14221224
2-(2-oxo-1,3-benzothiazol-3-yl)-N-piperidin-1-ylacetamide (PubChem CID 14221224) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-(2-oxo-1,3-benzothiazol-3-yl)-N-piperidin-1-ylacetamide.
| Compound Name | 2-(2-oxo-1,3-benzothiazol-3-yl)-N-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 14221224 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-(2-oxo-1,3-benzothiazol-3-yl)-N-piperidin-1-ylacetamide |
| SMILES | O=C(Cn1c(=O)sc2ccccc21)NN1CCCCC1 |
| InChI | InChI=1S/C14H17N3O2S/c18-13(15-16-8-4-1-5-9-16)10-17-11-6-2-3-7-12(11)20-14(17)19/h2-3,6-7H,1,4-5,8-10H2,(H,15,18) |
| InChIKey | BYTVVHFDMIDAFU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |