C14H10ClNO2S — CID 4576921
3-[(2-chlorophenoxy)methyl]-1,3-benzothiazol-2-one (PubChem CID 4576921) has the molecular formula C14H10ClNO2S and a molecular weight of 291.76 g/mol. Its IUPAC name is 3-[(2-chlorophenoxy)methyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[(2-chlorophenoxy)methyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 4576921 |
| Molecular Formula | C14H10ClNO2S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 3-[(2-chlorophenoxy)methyl]-1,3-benzothiazol-2-one |
| SMILES | O=c1sc2ccccc2n1COc1ccccc1Cl |
| InChI | InChI=1S/C14H10ClNO2S/c15-10-5-1-3-7-12(10)18-9-16-11-6-2-4-8-13(11)19-14(16)17/h1-8H,9H2 |
| InChIKey | QFFNSZDBHVXCMO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |