C11H10ClNO4S — CID 4215535
2-chloroethyl (2-oxo-1,3-benzothiazol-3-yl)methyl carbonate (PubChem CID 4215535) has the molecular formula C11H10ClNO4S and a molecular weight of 287.72 g/mol. Its IUPAC name is 2-chloroethyl (2-oxo-1,3-benzothiazol-3-yl)methyl carbonate.
| Compound Name | 2-chloroethyl (2-oxo-1,3-benzothiazol-3-yl)methyl carbonate |
|---|---|
| PubChem CID | 4215535 |
| Molecular Formula | C11H10ClNO4S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-chloroethyl (2-oxo-1,3-benzothiazol-3-yl)methyl carbonate |
| SMILES | O=C(OCCCl)OCn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C11H10ClNO4S/c12-5-6-16-11(15)17-7-13-8-3-1-2-4-9(8)18-10(13)14/h1-4H,5-7H2 |
| InChIKey | FVSCWTORERDIQT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|