C16H14N2O3S — CID 1081529
N-(2-methoxyphenyl)-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide (PubChem CID 1081529) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 1081529 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-(2-methoxyphenyl)-2-(2-oxo-1,3-benzothiazol-3-yl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C16H14N2O3S/c1-21-13-8-4-2-6-11(13)17-15(19)10-18-12-7-3-5-9-14(12)22-16(18)20/h2-9H,10H2,1H3,(H,17,19) |
| InChIKey | OCIZIKVAGNHNBN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |