C20H27N3O3+2 — CID 6981277
1-[(4-ethoxyphenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium (PubChem CID 6981277) has the molecular formula C20H27N3O3+2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6981277 |
| Molecular Formula | C20H27N3O3+2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium |
| SMILES | CCOc1ccc(C[NH+]2CC[NH+](Cc3cccc([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-26-20-8-6-17(7-9-20)15-21-10-12-22(13-11-21)16-18-4-3-5-19(14-18)23(24)25/h3-9,14H,2,10-13,15-16H2,1H3/p+2 |
| InChIKey | PSNZITHFEGRQJS-UHFFFAOYSA-P |
| XLogP | 0.48 |
| TPSA | 61.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|