C19H24N3O3+ — CID 6983091
1-(2-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]piperazin-4-ium (PubChem CID 6983091) has the molecular formula C19H24N3O3+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 6983091 |
| Molecular Formula | C19H24N3O3+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-(2-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]piperazin-4-ium |
| SMILES | CCOc1ccccc1N1CC[NH+](Cc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H23N3O3/c1-2-25-19-9-4-3-8-18(19)21-12-10-20(11-13-21)15-16-6-5-7-17(14-16)22(23)24/h3-9,14H,2,10-13,15H2,1H3/p+1 |
| InChIKey | MEKQWPSAGAIWRK-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|