C21H29N2O2+ — CID 6940003
1-(2-ethoxyphenyl)-4-[(4-methoxy-3-methylphenyl)methyl]piperazin-4-ium (PubChem CID 6940003) has the molecular formula C21H29N2O2+ and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-4-[(4-methoxy-3-methylphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2-ethoxyphenyl)-4-[(4-methoxy-3-methylphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 6940003 |
| Molecular Formula | C21H29N2O2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-(2-ethoxyphenyl)-4-[(4-methoxy-3-methylphenyl)methyl]piperazin-4-ium |
| SMILES | CCOc1ccccc1N1CC[NH+](Cc2ccc(OC)c(C)c2)CC1 |
| InChI | InChI=1S/C21H28N2O2/c1-4-25-21-8-6-5-7-19(21)23-13-11-22(12-14-23)16-18-9-10-20(24-3)17(2)15-18/h5-10,15H,4,11-14,16H2,1-3H3/p+1 |
| InChIKey | SZDPHVGUAPKJRH-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 26.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|