C18H23N3O2+2 — CID 6939615
1-benzyl-4-[(4-nitrophenyl)methyl]piperazine-1,4-diium (PubChem CID 6939615) has the molecular formula C18H23N3O2+2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-benzyl-4-[(4-nitrophenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-[(4-nitrophenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6939615 |
| Molecular Formula | C18H23N3O2+2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-benzyl-4-[(4-nitrophenyl)methyl]piperazine-1,4-diium |
| SMILES | O=[N+]([O-])c1ccc(C[NH+]2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C18H21N3O2/c22-21(23)18-8-6-17(7-9-18)15-20-12-10-19(11-13-20)14-16-4-2-1-3-5-16/h1-9H,10-15H2/p+2 |
| InChIKey | JSPBNJMOQJJJJH-UHFFFAOYSA-P |
| XLogP | 0.08 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|