C20H17N3O2 — CID 129404329
(2S,4S)-2-(3-nitrophenyl)-4-phenyl-1,2,3,4-tetrahydroquinazoline (PubChem CID 129404329) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is (2S,4S)-2-(3-nitrophenyl)-4-phenyl-1,2,3,4-tetrahydroquinazoline.
| Compound Name | (2S,4S)-2-(3-nitrophenyl)-4-phenyl-1,2,3,4-tetrahydroquinazoline |
|---|---|
| PubChem CID | 129404329 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (2S,4S)-2-(3-nitrophenyl)-4-phenyl-1,2,3,4-tetrahydroquinazoline |
| SMILES | O=[N+]([O-])c1cccc([C@@H]2Nc3ccccc3[C@H](c3ccccc3)N2)c1 |
| InChI | InChI=1S/C20H17N3O2/c24-23(25)16-10-6-9-15(13-16)20-21-18-12-5-4-11-17(18)19(22-20)14-7-2-1-3-8-14/h1-13,19-22H/t19-,20+/m0/s1 |
| InChIKey | CEMPHSOTXGVDTB-VQTJNVASSA-N |
| XLogP | 4.40 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|